C14H29NO2 — CID 176680501
5-hydroxy-N-(2,2,4,4-tetramethylpentyl)pentanamide (PubChem CID 176680501) has the molecular formula C14H29NO2 and a molecular weight of 243.39 g/mol. Its IUPAC name is 5-hydroxy-N-(2,2,4,4-tetramethylpentyl)pentanamide.
| Compound Name | 5-hydroxy-N-(2,2,4,4-tetramethylpentyl)pentanamide |
|---|---|
| PubChem CID | 176680501 |
| Molecular Formula | C14H29NO2 |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.22 |
| IUPAC Name | 5-hydroxy-N-(2,2,4,4-tetramethylpentyl)pentanamide |
| SMILES | CC(C)(C)CC(C)(C)CNC(=O)CCCCO |
| InChI | InChI=1S/C14H29NO2/c1-13(2,3)10-14(4,5)11-15-12(17)8-6-7-9-16/h16H,6-11H2,1-5H3,(H,15,17) |
| InChIKey | ILBYSDXGUUVRTA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|