About 3-methyl-4-sulfanyl-5,6-dihydro-1,2,4-oxadiazine
3-methyl-4-sulfanyl-5,6-dihydro-1,2,4-oxadiazine (PubChem CID 176680689) has the molecular formula C4H8N2OS
and a molecular weight of 132.19 g/mol. Its IUPAC name is 3-methyl-4-sulfanyl-5,6-dihydro-1,2,4-oxadiazine.
Molecular Properties
| Compound Name | 3-methyl-4-sulfanyl-5,6-dihydro-1,2,4-oxadiazine |
| PubChem CID | 176680689 |
| Molecular Formula | C4H8N2OS |
| Molecular Weight | 132.19 g/mol |
| Exact Mass | 132.04 |
| IUPAC Name | 3-methyl-4-sulfanyl-5,6-dihydro-1,2,4-oxadiazine |
| SMILES | CC1=NOCCN1S |
| InChI | InChI=1S/C4H8N2OS/c1-4-5-7-3-2-6(4)8/h8H,2-3H2,1H3 |
| InChIKey | GNDZTIWHTZATKR-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 24.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.19 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-4-sulfanyl-5,6-dihydro-1,2,4-oxadiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-4-sulfanyl-5,6-dihydro-1,2,4-oxadiazine?
The IUPAC name of 3-methyl-4-sulfanyl-5,6-dihydro-1,2,4-oxadiazine (CID 176680689) is 3-methyl-4-sulfanyl-5,6-dihydro-1,2,4-oxadiazine.
What is the SMILES notation for 3-methyl-4-sulfanyl-5,6-dihydro-1,2,4-oxadiazine?
The canonical SMILES for 3-methyl-4-sulfanyl-5,6-dihydro-1,2,4-oxadiazine is CC1=NOCCN1S.
What is the InChIKey of 3-methyl-4-sulfanyl-5,6-dihydro-1,2,4-oxadiazine?
The InChIKey is GNDZTIWHTZATKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N2OS/c1-4-5-7-3-2-6(4)8/h8H,2-3H2,1H3.
What are the key properties of 3-methyl-4-sulfanyl-5,6-dihydro-1,2,4-oxadiazine?
3-methyl-4-sulfanyl-5,6-dihydro-1,2,4-oxadiazine has a molecular weight of 132.19 g/mol, XLogP of 0.50, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-4-sulfanyl-5,6-dihydro-1,2,4-oxadiazine is sourced from PubChem (CID 176680689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).