About 2-cyanoethoxy-N,N-di(propan-2-yl)phosphonamidous acid;4-ethenyl-2-pyrrolidin-1-ylpyrimidine
2-cyanoethoxy-N,N-di(propan-2-yl)phosphonamidous acid;4-ethenyl-2-pyrrolidin-1-ylpyrimidine (PubChem CID 176680723) has the molecular formula C19H32N5O2P
and a molecular weight of 393.47 g/mol. Its IUPAC name is 2-cyanoethoxy-N,N-di(propan-2-yl)phosphonamidous acid;4-ethenyl-2-pyrrolidin-1-ylpyrimidine.
Molecular Properties
| Compound Name | 2-cyanoethoxy-N,N-di(propan-2-yl)phosphonamidous acid;4-ethenyl-2-pyrrolidin-1-ylpyrimidine |
| PubChem CID | 176680723 |
| Molecular Formula | C19H32N5O2P |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | 2-cyanoethoxy-N,N-di(propan-2-yl)phosphonamidous acid;4-ethenyl-2-pyrrolidin-1-ylpyrimidine |
| SMILES | C=Cc1ccnc(N2CCCC2)n1.CC(C)N(C(C)C)P(O)OCCC#N |
| InChI | InChI=1S/C10H13N3.C9H19N2O2P/c1-2-9-5-6-11-10(12-9)13-7-3-4-8-13;1-8(2)11(9(3)4)14(12)13-7-5-6-10/h2,5-6H,1,3-4,7-8H2;8-9,12H,5,7H2,1-4H3 |
| InChIKey | QVCGNDYTLBSPGE-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 85.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-cyanoethoxy-N,N-di(propan-2-yl)phosphonamidous acid;4-ethenyl-2-pyrrolidin-1-ylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyanoethoxy-N,N-di(propan-2-yl)phosphonamidous acid;4-ethenyl-2-pyrrolidin-1-ylpyrimidine?
The IUPAC name of 2-cyanoethoxy-N,N-di(propan-2-yl)phosphonamidous acid;4-ethenyl-2-pyrrolidin-1-ylpyrimidine (CID 176680723) is 2-cyanoethoxy-N,N-di(propan-2-yl)phosphonamidous acid;4-ethenyl-2-pyrrolidin-1-ylpyrimidine.
What is the SMILES notation for 2-cyanoethoxy-N,N-di(propan-2-yl)phosphonamidous acid;4-ethenyl-2-pyrrolidin-1-ylpyrimidine?
The canonical SMILES for 2-cyanoethoxy-N,N-di(propan-2-yl)phosphonamidous acid;4-ethenyl-2-pyrrolidin-1-ylpyrimidine is C=Cc1ccnc(N2CCCC2)n1.CC(C)N(C(C)C)P(O)OCCC#N.
What is the InChIKey of 2-cyanoethoxy-N,N-di(propan-2-yl)phosphonamidous acid;4-ethenyl-2-pyrrolidin-1-ylpyrimidine?
The InChIKey is QVCGNDYTLBSPGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3.C9H19N2O2P/c1-2-9-5-6-11-10(12-9)13-7-3-4-8-13;1-8(2)11(9(3)4)14(12)13-7-5-6-10/h2,5-6H,1,3-4,7-8H2;8-9,12H,5,7H2,1-4H3.
What are the key properties of 2-cyanoethoxy-N,N-di(propan-2-yl)phosphonamidous acid;4-ethenyl-2-pyrrolidin-1-ylpyrimidine?
2-cyanoethoxy-N,N-di(propan-2-yl)phosphonamidous acid;4-ethenyl-2-pyrrolidin-1-ylpyrimidine has a molecular weight of 393.47 g/mol, XLogP of 3.97, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyanoethoxy-N,N-di(propan-2-yl)phosphonamidous acid;4-ethenyl-2-pyrrolidin-1-ylpyrimidine is sourced from PubChem (CID 176680723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).