About 2-ethenyl-N,N-dimethylpyrimidin-4-amine
2-ethenyl-N,N-dimethylpyrimidin-4-amine (PubChem CID 176680804) has the molecular formula C8H11N3
and a molecular weight of 149.20 g/mol. Its IUPAC name is 2-ethenyl-N,N-dimethylpyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-ethenyl-N,N-dimethylpyrimidin-4-amine |
| PubChem CID | 176680804 |
| Molecular Formula | C8H11N3 |
| Molecular Weight | 149.20 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | 2-ethenyl-N,N-dimethylpyrimidin-4-amine |
| SMILES | C=Cc1nccc(N(C)C)n1 |
| InChI | InChI=1S/C8H11N3/c1-4-7-9-6-5-8(10-7)11(2)3/h4-6H,1H2,2-3H3 |
| InChIKey | JGZBFRWLDANRGW-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.20 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethenyl-N,N-dimethylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenyl-N,N-dimethylpyrimidin-4-amine?
The IUPAC name of 2-ethenyl-N,N-dimethylpyrimidin-4-amine (CID 176680804) is 2-ethenyl-N,N-dimethylpyrimidin-4-amine.
What is the SMILES notation for 2-ethenyl-N,N-dimethylpyrimidin-4-amine?
The canonical SMILES for 2-ethenyl-N,N-dimethylpyrimidin-4-amine is C=Cc1nccc(N(C)C)n1.
What is the InChIKey of 2-ethenyl-N,N-dimethylpyrimidin-4-amine?
The InChIKey is JGZBFRWLDANRGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3/c1-4-7-9-6-5-8(10-7)11(2)3/h4-6H,1H2,2-3H3.
What are the key properties of 2-ethenyl-N,N-dimethylpyrimidin-4-amine?
2-ethenyl-N,N-dimethylpyrimidin-4-amine has a molecular weight of 149.20 g/mol, XLogP of 1.19, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenyl-N,N-dimethylpyrimidin-4-amine is sourced from PubChem (CID 176680804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).