About (3-aminocyclopentyl)oxyphosphinous acid;propane
(3-aminocyclopentyl)oxyphosphinous acid;propane (PubChem CID 176680866) has the molecular formula C8H20NO2P
and a molecular weight of 193.23 g/mol. Its IUPAC name is (3-aminocyclopentyl)oxyphosphinous acid;propane.
Molecular Properties
| Compound Name | (3-aminocyclopentyl)oxyphosphinous acid;propane |
| PubChem CID | 176680866 |
| Molecular Formula | C8H20NO2P |
| Molecular Weight | 193.23 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | (3-aminocyclopentyl)oxyphosphinous acid;propane |
| SMILES | CCC.NC1CCC(OPO)C1 |
| InChI | InChI=1S/C5H12NO2P.C3H8/c6-4-1-2-5(3-4)8-9-7;1-3-2/h4-5,7,9H,1-3,6H2;3H2,1-2H3 |
| InChIKey | KYRTZRDLUHKREV-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.23 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (3-aminocyclopentyl)oxyphosphinous acid;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-aminocyclopentyl)oxyphosphinous acid;propane?
The IUPAC name of (3-aminocyclopentyl)oxyphosphinous acid;propane (CID 176680866) is (3-aminocyclopentyl)oxyphosphinous acid;propane.
What is the SMILES notation for (3-aminocyclopentyl)oxyphosphinous acid;propane?
The canonical SMILES for (3-aminocyclopentyl)oxyphosphinous acid;propane is CCC.NC1CCC(OPO)C1.
What is the InChIKey of (3-aminocyclopentyl)oxyphosphinous acid;propane?
The InChIKey is KYRTZRDLUHKREV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12NO2P.C3H8/c6-4-1-2-5(3-4)8-9-7;1-3-2/h4-5,7,9H,1-3,6H2;3H2,1-2H3.
What are the key properties of (3-aminocyclopentyl)oxyphosphinous acid;propane?
(3-aminocyclopentyl)oxyphosphinous acid;propane has a molecular weight of 193.23 g/mol, XLogP of 1.80, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-aminocyclopentyl)oxyphosphinous acid;propane is sourced from PubChem (CID 176680866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).