C18H27BrN4O2 — CID 176681017
tert-butyl 4-[2-[(2-amino-6-bromophenyl)methylideneamino]ethyl]piperazine-1-carboxylate (PubChem CID 176681017) has the molecular formula C18H27BrN4O2 and a molecular weight of 411.34 g/mol. Its IUPAC name is tert-butyl 4-[2-[(2-amino-6-bromophenyl)methylideneamino]ethyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[(2-amino-6-bromophenyl)methylideneamino]ethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 176681017 |
| Molecular Formula | C18H27BrN4O2 |
| Molecular Weight | 411.34 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | tert-butyl 4-[2-[(2-amino-6-bromophenyl)methylideneamino]ethyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC/N=C/c2c(N)cccc2Br)CC1 |
| InChI | InChI=1S/C18H27BrN4O2/c1-18(2,3)25-17(24)23-11-9-22(10-12-23)8-7-21-13-14-15(19)5-4-6-16(14)20/h4-6,13H,7-12,20H2,1-3H3/b21-13+ |
| InChIKey | CZOGYPNPMRDYNV-FYJGNVAPSA-N |
| XLogP | 3.00 |
| TPSA | 71.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.34 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|