C17H19FN4O — CID 176681653
3-(6,9-diazaspiro[4.5]dec-2-en-6-ylmethyl)-7-fluoropyrido[1,2-a]pyrimidin-4-one (PubChem CID 176681653) has the molecular formula C17H19FN4O and a molecular weight of 314.36 g/mol. Its IUPAC name is 3-(6,9-diazaspiro[4.5]dec-2-en-6-ylmethyl)-7-fluoropyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 3-(6,9-diazaspiro[4.5]dec-2-en-6-ylmethyl)-7-fluoropyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 176681653 |
| Molecular Formula | C17H19FN4O |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 3-(6,9-diazaspiro[4.5]dec-2-en-6-ylmethyl)-7-fluoropyrido[1,2-a]pyrimidin-4-one |
| SMILES | O=c1c(CN2CCNCC23CC=CC3)cnc2ccc(F)cn12 |
| InChI | InChI=1S/C17H19FN4O/c18-14-3-4-15-20-9-13(16(23)22(15)11-14)10-21-8-7-19-12-17(21)5-1-2-6-17/h1-4,9,11,19H,5-8,10,12H2 |
| InChIKey | KGLPTOJUGBSLBX-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|