About 8-chloro-3-(6,9-diazaspiro[4.5]decan-6-ylmethyl)pyrido[1,2-a]pyrimidin-4-one
8-chloro-3-(6,9-diazaspiro[4.5]decan-6-ylmethyl)pyrido[1,2-a]pyrimidin-4-one (PubChem CID 176681668) has the molecular formula C17H21ClN4O
and a molecular weight of 332.83 g/mol. Its IUPAC name is 8-chloro-3-(6,9-diazaspiro[4.5]decan-6-ylmethyl)pyrido[1,2-a]pyrimidin-4-one.
Molecular Properties
| Compound Name | 8-chloro-3-(6,9-diazaspiro[4.5]decan-6-ylmethyl)pyrido[1,2-a]pyrimidin-4-one |
| PubChem CID | 176681668 |
| Molecular Formula | C17H21ClN4O |
| Molecular Weight | 332.83 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 8-chloro-3-(6,9-diazaspiro[4.5]decan-6-ylmethyl)pyrido[1,2-a]pyrimidin-4-one |
| SMILES | O=c1c(CN2CCNCC23CCCC3)cnc2cc(Cl)ccn12 |
| InChI | InChI=1S/C17H21ClN4O/c18-14-3-7-22-15(9-14)20-10-13(16(22)23)11-21-8-6-19-12-17(21)4-1-2-5-17/h3,7,9-10,19H,1-2,4-6,8,11-12H2 |
| InChIKey | AQMPYWAGJOQOBX-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.83 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-chloro-3-(6,9-diazaspiro[4.5]decan-6-ylmethyl)pyrido[1,2-a]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-3-(6,9-diazaspiro[4.5]decan-6-ylmethyl)pyrido[1,2-a]pyrimidin-4-one?
The IUPAC name of 8-chloro-3-(6,9-diazaspiro[4.5]decan-6-ylmethyl)pyrido[1,2-a]pyrimidin-4-one (CID 176681668) is 8-chloro-3-(6,9-diazaspiro[4.5]decan-6-ylmethyl)pyrido[1,2-a]pyrimidin-4-one.
What is the SMILES notation for 8-chloro-3-(6,9-diazaspiro[4.5]decan-6-ylmethyl)pyrido[1,2-a]pyrimidin-4-one?
The canonical SMILES for 8-chloro-3-(6,9-diazaspiro[4.5]decan-6-ylmethyl)pyrido[1,2-a]pyrimidin-4-one is O=c1c(CN2CCNCC23CCCC3)cnc2cc(Cl)ccn12.
What is the InChIKey of 8-chloro-3-(6,9-diazaspiro[4.5]decan-6-ylmethyl)pyrido[1,2-a]pyrimidin-4-one?
The InChIKey is AQMPYWAGJOQOBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21ClN4O/c18-14-3-7-22-15(9-14)20-10-13(16(22)23)11-21-8-6-19-12-17(21)4-1-2-5-17/h3,7,9-10,19H,1-2,4-6,8,11-12H2.
What are the key properties of 8-chloro-3-(6,9-diazaspiro[4.5]decan-6-ylmethyl)pyrido[1,2-a]pyrimidin-4-one?
8-chloro-3-(6,9-diazaspiro[4.5]decan-6-ylmethyl)pyrido[1,2-a]pyrimidin-4-one has a molecular weight of 332.83 g/mol, XLogP of 2.07, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-3-(6,9-diazaspiro[4.5]decan-6-ylmethyl)pyrido[1,2-a]pyrimidin-4-one is sourced from PubChem (CID 176681668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).