About 3-(6,9-diazaspiro[4.5]decan-6-ylmethyl)chromen-4-one;hydrochloride
3-(6,9-diazaspiro[4.5]decan-6-ylmethyl)chromen-4-one;hydrochloride (PubChem CID 176681696) has the molecular formula C18H23ClN2O2
and a molecular weight of 334.85 g/mol. Its IUPAC name is 3-(6,9-diazaspiro[4.5]decan-6-ylmethyl)chromen-4-one;hydrochloride.
Molecular Properties
| Compound Name | 3-(6,9-diazaspiro[4.5]decan-6-ylmethyl)chromen-4-one;hydrochloride |
| PubChem CID | 176681696 |
| Molecular Formula | C18H23ClN2O2 |
| Molecular Weight | 334.85 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 3-(6,9-diazaspiro[4.5]decan-6-ylmethyl)chromen-4-one;hydrochloride |
| SMILES | Cl.O=c1c(CN2CCNCC23CCCC3)coc2ccccc12 |
| InChI | InChI=1S/C18H22N2O2.ClH/c21-17-14(12-22-16-6-2-1-5-15(16)17)11-20-10-9-19-13-18(20)7-3-4-8-18;/h1-2,5-6,12,19H,3-4,7-11,13H2;1H |
| InChIKey | CPWXAJYQFZSXIW-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.85 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(6,9-diazaspiro[4.5]decan-6-ylmethyl)chromen-4-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6,9-diazaspiro[4.5]decan-6-ylmethyl)chromen-4-one;hydrochloride?
The IUPAC name of 3-(6,9-diazaspiro[4.5]decan-6-ylmethyl)chromen-4-one;hydrochloride (CID 176681696) is 3-(6,9-diazaspiro[4.5]decan-6-ylmethyl)chromen-4-one;hydrochloride.
What is the SMILES notation for 3-(6,9-diazaspiro[4.5]decan-6-ylmethyl)chromen-4-one;hydrochloride?
The canonical SMILES for 3-(6,9-diazaspiro[4.5]decan-6-ylmethyl)chromen-4-one;hydrochloride is Cl.O=c1c(CN2CCNCC23CCCC3)coc2ccccc12.
What is the InChIKey of 3-(6,9-diazaspiro[4.5]decan-6-ylmethyl)chromen-4-one;hydrochloride?
The InChIKey is CPWXAJYQFZSXIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N2O2.ClH/c21-17-14(12-22-16-6-2-1-5-15(16)17)11-20-10-9-19-13-18(20)7-3-4-8-18;/h1-2,5-6,12,19H,3-4,7-11,13H2;1H.
What are the key properties of 3-(6,9-diazaspiro[4.5]decan-6-ylmethyl)chromen-4-one;hydrochloride?
3-(6,9-diazaspiro[4.5]decan-6-ylmethyl)chromen-4-one;hydrochloride has a molecular weight of 334.85 g/mol, XLogP of 2.93, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6,9-diazaspiro[4.5]decan-6-ylmethyl)chromen-4-one;hydrochloride is sourced from PubChem (CID 176681696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).