About 3-(6,9-diazaspiro[4.5]decan-6-ylmethyl)pyrimido[1,2-b]pyridazin-4-one
3-(6,9-diazaspiro[4.5]decan-6-ylmethyl)pyrimido[1,2-b]pyridazin-4-one (PubChem CID 176681745) has the molecular formula C16H21N5O
and a molecular weight of 299.38 g/mol. Its IUPAC name is 3-(6,9-diazaspiro[4.5]decan-6-ylmethyl)pyrimido[1,2-b]pyridazin-4-one.
Molecular Properties
| Compound Name | 3-(6,9-diazaspiro[4.5]decan-6-ylmethyl)pyrimido[1,2-b]pyridazin-4-one |
| PubChem CID | 176681745 |
| Molecular Formula | C16H21N5O |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 3-(6,9-diazaspiro[4.5]decan-6-ylmethyl)pyrimido[1,2-b]pyridazin-4-one |
| SMILES | O=c1c(CN2CCNCC23CCCC3)cnc2cccnn12 |
| InChI | InChI=1S/C16H21N5O/c22-15-13(10-18-14-4-3-7-19-21(14)15)11-20-9-8-17-12-16(20)5-1-2-6-16/h3-4,7,10,17H,1-2,5-6,8-9,11-12H2 |
| InChIKey | NMGHECIRIPIQOU-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(6,9-diazaspiro[4.5]decan-6-ylmethyl)pyrimido[1,2-b]pyridazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6,9-diazaspiro[4.5]decan-6-ylmethyl)pyrimido[1,2-b]pyridazin-4-one?
The IUPAC name of 3-(6,9-diazaspiro[4.5]decan-6-ylmethyl)pyrimido[1,2-b]pyridazin-4-one (CID 176681745) is 3-(6,9-diazaspiro[4.5]decan-6-ylmethyl)pyrimido[1,2-b]pyridazin-4-one.
What is the SMILES notation for 3-(6,9-diazaspiro[4.5]decan-6-ylmethyl)pyrimido[1,2-b]pyridazin-4-one?
The canonical SMILES for 3-(6,9-diazaspiro[4.5]decan-6-ylmethyl)pyrimido[1,2-b]pyridazin-4-one is O=c1c(CN2CCNCC23CCCC3)cnc2cccnn12.
What is the InChIKey of 3-(6,9-diazaspiro[4.5]decan-6-ylmethyl)pyrimido[1,2-b]pyridazin-4-one?
The InChIKey is NMGHECIRIPIQOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N5O/c22-15-13(10-18-14-4-3-7-19-21(14)15)11-20-9-8-17-12-16(20)5-1-2-6-16/h3-4,7,10,17H,1-2,5-6,8-9,11-12H2.
What are the key properties of 3-(6,9-diazaspiro[4.5]decan-6-ylmethyl)pyrimido[1,2-b]pyridazin-4-one?
3-(6,9-diazaspiro[4.5]decan-6-ylmethyl)pyrimido[1,2-b]pyridazin-4-one has a molecular weight of 299.38 g/mol, XLogP of 0.81, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6,9-diazaspiro[4.5]decan-6-ylmethyl)pyrimido[1,2-b]pyridazin-4-one is sourced from PubChem (CID 176681745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).