C18H20ClFN4O2 — CID 176681781
6-[(7-fluoro-4-oxopyrido[1,2-a]pyrimidin-3-yl)methyl]-6,9-diazaspiro[4.5]decane-9-carbonyl chloride (PubChem CID 176681781) has the molecular formula C18H20ClFN4O2 and a molecular weight of 378.84 g/mol. Its IUPAC name is 6-[(7-fluoro-4-oxopyrido[1,2-a]pyrimidin-3-yl)methyl]-6,9-diazaspiro[4.5]decane-9-carbonyl chloride.
| Compound Name | 6-[(7-fluoro-4-oxopyrido[1,2-a]pyrimidin-3-yl)methyl]-6,9-diazaspiro[4.5]decane-9-carbonyl chloride |
|---|---|
| PubChem CID | 176681781 |
| Molecular Formula | C18H20ClFN4O2 |
| Molecular Weight | 378.84 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | 6-[(7-fluoro-4-oxopyrido[1,2-a]pyrimidin-3-yl)methyl]-6,9-diazaspiro[4.5]decane-9-carbonyl chloride |
| SMILES | O=C(Cl)N1CCN(Cc2cnc3ccc(F)cn3c2=O)C2(CCCC2)C1 |
| InChI | InChI=1S/C18H20ClFN4O2/c19-17(26)22-7-8-23(18(12-22)5-1-2-6-18)10-13-9-21-15-4-3-14(20)11-24(15)16(13)25/h3-4,9,11H,1-2,5-8,10,12H2 |
| InChIKey | KUHWWTNEHMJIIR-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 57.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.84 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|