C30H36F2N6O2 — CID 176681971
3-[[9-[(2S,4R)-2-(2,5-difluorophenyl)-4-(methylamino)piperidine-1-carbonyl]-6,9-diazaspiro[4.5]decan-6-yl]methyl]pyrido[1,2-a]pyrimidin-4-one (PubChem CID 176681971) has the molecular formula C30H36F2N6O2 and a molecular weight of 550.65 g/mol. Its IUPAC name is 3-[[9-[(2S,4R)-2-(2,5-difluorophenyl)-4-(methylamino)piperidine-1-carbonyl]-6,9-diazaspiro[4.5]decan-6-yl]methyl]pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 3-[[9-[(2S,4R)-2-(2,5-difluorophenyl)-4-(methylamino)piperidine-1-carbonyl]-6,9-diazaspiro[4.5]decan-6-yl]methyl]pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 176681971 |
| Molecular Formula | C30H36F2N6O2 |
| Molecular Weight | 550.65 g/mol |
| Exact Mass | 550.29 |
| IUPAC Name | 3-[[9-[(2S,4R)-2-(2,5-difluorophenyl)-4-(methylamino)piperidine-1-carbonyl]-6,9-diazaspiro[4.5]decan-6-yl]methyl]pyrido[1,2-a]pyrimidin-4-one |
| SMILES | CN[C@@H]1CCN(C(=O)N2CCN(Cc3cnc4ccccn4c3=O)C3(CCCC3)C2)[C@H](c2cc(F)ccc2F)C1 |
| InChI | InChI=1S/C30H36F2N6O2/c1-33-23-9-13-37(26(17-23)24-16-22(31)7-8-25(24)32)29(40)35-14-15-36(30(20-35)10-3-4-11-30)19-21-18-34-27-6-2-5-12-38(27)28(21)39/h2,5-8,12,16,18,23,26,33H,3-4,9-11,13-15,17,19-20H2,1H3/t23-,26+/m1/s1 |
| InChIKey | XJMGBSLOJVZOLZ-BVAGGSTKSA-N |
| XLogP | 3.95 |
| TPSA | 73.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.65 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |