C19H24N4 — CID 176682029
(7Z)-7,8-bis(ethenyl)-5-methyl-10-propan-2-yl-3,4,5,10-tetrazatricyclo[9.4.0.02,6]pentadeca-1(15),3,7,11,13-pentaene (PubChem CID 176682029) has the molecular formula C19H24N4 and a molecular weight of 308.43 g/mol. Its IUPAC name is (7Z)-7,8-bis(ethenyl)-5-methyl-10-propan-2-yl-3,4,5,10-tetrazatricyclo[9.4.0.02,6]pentadeca-1(15),3,7,11,13-pentaene.
| Compound Name | (7Z)-7,8-bis(ethenyl)-5-methyl-10-propan-2-yl-3,4,5,10-tetrazatricyclo[9.4.0.02,6]pentadeca-1(15),3,7,11,13-pentaene |
|---|---|
| PubChem CID | 176682029 |
| Molecular Formula | C19H24N4 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | (7Z)-7,8-bis(ethenyl)-5-methyl-10-propan-2-yl-3,4,5,10-tetrazatricyclo[9.4.0.02,6]pentadeca-1(15),3,7,11,13-pentaene |
| SMILES | C=C/C1=C(\C=C)C2C(N=NN2C)c2ccccc2N(C(C)C)C1 |
| InChI | InChI=1S/C19H24N4/c1-6-14-12-23(13(3)4)17-11-9-8-10-16(17)18-19(15(14)7-2)22(5)21-20-18/h6-11,13,18-19H,1-2,12H2,3-5H3/b15-14- |
| InChIKey | LNLYHUFTVOSDPO-PFONDFGASA-N |
| XLogP | 4.31 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |