C17H25N3O2 — CID 176682447
tert-butyl 4-amino-3-pyrimidin-5-ylbicyclo[2.2.2]octane-1-carboxylate (PubChem CID 176682447) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is tert-butyl 4-amino-3-pyrimidin-5-ylbicyclo[2.2.2]octane-1-carboxylate.
| Compound Name | tert-butyl 4-amino-3-pyrimidin-5-ylbicyclo[2.2.2]octane-1-carboxylate |
|---|---|
| PubChem CID | 176682447 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | tert-butyl 4-amino-3-pyrimidin-5-ylbicyclo[2.2.2]octane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)C12CCC(N)(CC1)C(c1cncnc1)C2 |
| InChI | InChI=1S/C17H25N3O2/c1-15(2,3)22-14(21)16-4-6-17(18,7-5-16)13(8-16)12-9-19-11-20-10-12/h9-11,13H,4-8,18H2,1-3H3 |
| InChIKey | KUYBIDBNIHIOBU-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |