About 4-[2-[(3,5-dimethylphenyl)methoxy]ethyl]-1,3-dioxol-2-one
4-[2-[(3,5-dimethylphenyl)methoxy]ethyl]-1,3-dioxol-2-one (PubChem CID 176683064) has the molecular formula C14H16O4
and a molecular weight of 248.28 g/mol. Its IUPAC name is 4-[2-[(3,5-dimethylphenyl)methoxy]ethyl]-1,3-dioxol-2-one.
Molecular Properties
| Compound Name | 4-[2-[(3,5-dimethylphenyl)methoxy]ethyl]-1,3-dioxol-2-one |
| PubChem CID | 176683064 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 4-[2-[(3,5-dimethylphenyl)methoxy]ethyl]-1,3-dioxol-2-one |
| SMILES | Cc1cc(C)cc(COCCc2coc(=O)o2)c1 |
| InChI | InChI=1S/C14H16O4/c1-10-5-11(2)7-12(6-10)8-16-4-3-13-9-17-14(15)18-13/h5-7,9H,3-4,8H2,1-2H3 |
| InChIKey | ZHCUDQHSUZWEPC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 52.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-[(3,5-dimethylphenyl)methoxy]ethyl]-1,3-dioxol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[(3,5-dimethylphenyl)methoxy]ethyl]-1,3-dioxol-2-one?
The IUPAC name of 4-[2-[(3,5-dimethylphenyl)methoxy]ethyl]-1,3-dioxol-2-one (CID 176683064) is 4-[2-[(3,5-dimethylphenyl)methoxy]ethyl]-1,3-dioxol-2-one.
What is the SMILES notation for 4-[2-[(3,5-dimethylphenyl)methoxy]ethyl]-1,3-dioxol-2-one?
The canonical SMILES for 4-[2-[(3,5-dimethylphenyl)methoxy]ethyl]-1,3-dioxol-2-one is Cc1cc(C)cc(COCCc2coc(=O)o2)c1.
What is the InChIKey of 4-[2-[(3,5-dimethylphenyl)methoxy]ethyl]-1,3-dioxol-2-one?
The InChIKey is ZHCUDQHSUZWEPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16O4/c1-10-5-11(2)7-12(6-10)8-16-4-3-13-9-17-14(15)18-13/h5-7,9H,3-4,8H2,1-2H3.
What are the key properties of 4-[2-[(3,5-dimethylphenyl)methoxy]ethyl]-1,3-dioxol-2-one?
4-[2-[(3,5-dimethylphenyl)methoxy]ethyl]-1,3-dioxol-2-one has a molecular weight of 248.28 g/mol, XLogP of 2.61, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[(3,5-dimethylphenyl)methoxy]ethyl]-1,3-dioxol-2-one is sourced from PubChem (CID 176683064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).