C23H19B2F5N6O2 — CID 176684228
CID 176684228 (PubChem CID 176684228) has the molecular formula C23H19B2F5N6O2 and a molecular weight of 528.06 g/mol.
| Compound Name | CID 176684228 |
|---|---|
| PubChem CID | 176684228 |
| Molecular Formula | C23H19B2F5N6O2 |
| Molecular Weight | 528.06 g/mol |
| Exact Mass | 528.17 |
| IUPAC Name | — |
| SMILES | [B]C([B])(Nc1ccc(C(F)(F)F)cn1)C1C(C)OC(F)(F)CN1C(=O)c1nc(C)ccc1-c1ncccn1 |
| InChI | InChI=1S/C23H19B2F5N6O2/c1-12-4-6-15(19-31-8-3-9-32-19)17(34-12)20(37)36-11-21(26,27)38-13(2)18(36)22(24,25)35-16-7-5-14(10-33-16)23(28,29)30/h3-10,13,18H,11H2,1-2H3,(H,33,35) |
| InChIKey | JCKUXFAZCMJLSW-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 93.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.06 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|