C19H26N2O4 — CID 176684654
1-O-tert-butyl 4-O-ethyl 5-(3-aminophenyl)-3,6-dihydro-2H-pyridine-1,4-dicarboxylate (PubChem CID 176684654) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is 1-O-tert-butyl 4-O-ethyl 5-(3-aminophenyl)-3,6-dihydro-2H-pyridine-1,4-dicarboxylate.
| Compound Name | 1-O-tert-butyl 4-O-ethyl 5-(3-aminophenyl)-3,6-dihydro-2H-pyridine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 176684654 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 1-O-tert-butyl 4-O-ethyl 5-(3-aminophenyl)-3,6-dihydro-2H-pyridine-1,4-dicarboxylate |
| SMILES | CCOC(=O)C1=C(c2cccc(N)c2)CN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C19H26N2O4/c1-5-24-17(22)15-9-10-21(18(23)25-19(2,3)4)12-16(15)13-7-6-8-14(20)11-13/h6-8,11H,5,9-10,12,20H2,1-4H3 |
| InChIKey | PBWIKXJCLCXHER-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|