C25H34N8O2 — CID 176685241
tert-butyl (2R,5S)-4-[7-(6-cyano-1,2-dihydropyridazin-4-yl)spiro[6H-pyrrolo[2,3-d]pyrimidine-5,1'-cyclobutane]-4-yl]-2,5-dimethylpiperazine-1-carboxylate (PubChem CID 176685241) has the molecular formula C25H34N8O2 and a molecular weight of 478.60 g/mol. Its IUPAC name is tert-butyl (2R,5S)-4-[7-(6-cyano-1,2-dihydropyridazin-4-yl)spiro[6H-pyrrolo[2,3-d]pyrimidine-5,1'-cyclobutane]-4-yl]-2,5-dimethylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2R,5S)-4-[7-(6-cyano-1,2-dihydropyridazin-4-yl)spiro[6H-pyrrolo[2,3-d]pyrimidine-5,1'-cyclobutane]-4-yl]-2,5-dimethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 176685241 |
| Molecular Formula | C25H34N8O2 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.28 |
| IUPAC Name | tert-butyl (2R,5S)-4-[7-(6-cyano-1,2-dihydropyridazin-4-yl)spiro[6H-pyrrolo[2,3-d]pyrimidine-5,1'-cyclobutane]-4-yl]-2,5-dimethylpiperazine-1-carboxylate |
| SMILES | C[C@@H]1CN(c2ncnc3c2C2(CCC2)CN3C2=CNNC(C#N)=C2)[C@@H](C)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H34N8O2/c1-16-13-32(23(34)35-24(3,4)5)17(2)12-31(16)21-20-22(28-15-27-21)33(14-25(20)7-6-8-25)19-9-18(10-26)30-29-11-19/h9,11,15-17,29-30H,6-8,12-14H2,1-5H3/t16-,17+/m0/s1 |
| InChIKey | UETLOOKKAOLKSQ-DLBZAZTESA-N |
| XLogP | 2.91 |
| TPSA | 109.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |