About ethane;6-ethyl-4-fluoro-1-propan-2-yl-7H-cyclohepta[d]imidazole;oxolane
ethane;6-ethyl-4-fluoro-1-propan-2-yl-7H-cyclohepta[d]imidazole;oxolane (PubChem CID 176685556) has the molecular formula C19H31FN2O
and a molecular weight of 322.47 g/mol. Its IUPAC name is ethane;6-ethyl-4-fluoro-1-propan-2-yl-7H-cyclohepta[d]imidazole;oxolane.
Molecular Properties
| Compound Name | ethane;6-ethyl-4-fluoro-1-propan-2-yl-7H-cyclohepta[d]imidazole;oxolane |
| PubChem CID | 176685556 |
| Molecular Formula | C19H31FN2O |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | ethane;6-ethyl-4-fluoro-1-propan-2-yl-7H-cyclohepta[d]imidazole;oxolane |
| SMILES | C1CCOC1.CC.CCC1=CC(F)=c2ncn(C(C)C)c2=CC1 |
| InChI | InChI=1S/C13H17FN2.C4H8O.C2H6/c1-4-10-5-6-12-13(11(14)7-10)15-8-16(12)9(2)3;1-2-4-5-3-1;1-2/h6-9H,4-5H2,1-3H3;1-4H2;1-2H3 |
| InChIKey | CGZNZKYPLNJVOS-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;6-ethyl-4-fluoro-1-propan-2-yl-7H-cyclohepta[d]imidazole;oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;6-ethyl-4-fluoro-1-propan-2-yl-7H-cyclohepta[d]imidazole;oxolane?
The IUPAC name of ethane;6-ethyl-4-fluoro-1-propan-2-yl-7H-cyclohepta[d]imidazole;oxolane (CID 176685556) is ethane;6-ethyl-4-fluoro-1-propan-2-yl-7H-cyclohepta[d]imidazole;oxolane.
What is the SMILES notation for ethane;6-ethyl-4-fluoro-1-propan-2-yl-7H-cyclohepta[d]imidazole;oxolane?
The canonical SMILES for ethane;6-ethyl-4-fluoro-1-propan-2-yl-7H-cyclohepta[d]imidazole;oxolane is C1CCOC1.CC.CCC1=CC(F)=c2ncn(C(C)C)c2=CC1.
What is the InChIKey of ethane;6-ethyl-4-fluoro-1-propan-2-yl-7H-cyclohepta[d]imidazole;oxolane?
The InChIKey is CGZNZKYPLNJVOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17FN2.C4H8O.C2H6/c1-4-10-5-6-12-13(11(14)7-10)15-8-16(12)9(2)3;1-2-4-5-3-1;1-2/h6-9H,4-5H2,1-3H3;1-4H2;1-2H3.
What are the key properties of ethane;6-ethyl-4-fluoro-1-propan-2-yl-7H-cyclohepta[d]imidazole;oxolane?
ethane;6-ethyl-4-fluoro-1-propan-2-yl-7H-cyclohepta[d]imidazole;oxolane has a molecular weight of 322.47 g/mol, XLogP of 3.89, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;6-ethyl-4-fluoro-1-propan-2-yl-7H-cyclohepta[d]imidazole;oxolane is sourced from PubChem (CID 176685556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).