About 6-fluoro-3-propan-2-yl-5,5a-dihydro-4aH-cyclopropa[f]benzimidazole
6-fluoro-3-propan-2-yl-5,5a-dihydro-4aH-cyclopropa[f]benzimidazole (PubChem CID 176685570) has the molecular formula C11H13FN2
and a molecular weight of 192.24 g/mol. Its IUPAC name is 6-fluoro-3-propan-2-yl-5,5a-dihydro-4aH-cyclopropa[f]benzimidazole.
Molecular Properties
| Compound Name | 6-fluoro-3-propan-2-yl-5,5a-dihydro-4aH-cyclopropa[f]benzimidazole |
| PubChem CID | 176685570 |
| Molecular Formula | C11H13FN2 |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | 6-fluoro-3-propan-2-yl-5,5a-dihydro-4aH-cyclopropa[f]benzimidazole |
| SMILES | CC(C)n1cnc2c1=CC1CC1C=2F |
| InChI | InChI=1S/C11H13FN2/c1-6(2)14-5-13-11-9(14)4-7-3-8(7)10(11)12/h4-8H,3H2,1-2H3 |
| InChIKey | XAVREPURWIHXBC-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-fluoro-3-propan-2-yl-5,5a-dihydro-4aH-cyclopropa[f]benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-3-propan-2-yl-5,5a-dihydro-4aH-cyclopropa[f]benzimidazole?
The IUPAC name of 6-fluoro-3-propan-2-yl-5,5a-dihydro-4aH-cyclopropa[f]benzimidazole (CID 176685570) is 6-fluoro-3-propan-2-yl-5,5a-dihydro-4aH-cyclopropa[f]benzimidazole.
What is the SMILES notation for 6-fluoro-3-propan-2-yl-5,5a-dihydro-4aH-cyclopropa[f]benzimidazole?
The canonical SMILES for 6-fluoro-3-propan-2-yl-5,5a-dihydro-4aH-cyclopropa[f]benzimidazole is CC(C)n1cnc2c1=CC1CC1C=2F.
What is the InChIKey of 6-fluoro-3-propan-2-yl-5,5a-dihydro-4aH-cyclopropa[f]benzimidazole?
The InChIKey is XAVREPURWIHXBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13FN2/c1-6(2)14-5-13-11-9(14)4-7-3-8(7)10(11)12/h4-8H,3H2,1-2H3.
What are the key properties of 6-fluoro-3-propan-2-yl-5,5a-dihydro-4aH-cyclopropa[f]benzimidazole?
6-fluoro-3-propan-2-yl-5,5a-dihydro-4aH-cyclopropa[f]benzimidazole has a molecular weight of 192.24 g/mol, XLogP of 0.97, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-3-propan-2-yl-5,5a-dihydro-4aH-cyclopropa[f]benzimidazole is sourced from PubChem (CID 176685570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).