About ethane;N-ethyl-1-(fluoromethyl)-N-propan-2-ylcyclopropan-1-amine
ethane;N-ethyl-1-(fluoromethyl)-N-propan-2-ylcyclopropan-1-amine (PubChem CID 176685786) has the molecular formula C11H24FN
and a molecular weight of 189.32 g/mol. Its IUPAC name is ethane;N-ethyl-1-(fluoromethyl)-N-propan-2-ylcyclopropan-1-amine.
Molecular Properties
| Compound Name | ethane;N-ethyl-1-(fluoromethyl)-N-propan-2-ylcyclopropan-1-amine |
| PubChem CID | 176685786 |
| Molecular Formula | C11H24FN |
| Molecular Weight | 189.32 g/mol |
| Exact Mass | 189.19 |
| IUPAC Name | ethane;N-ethyl-1-(fluoromethyl)-N-propan-2-ylcyclopropan-1-amine |
| SMILES | CC.CCN(C(C)C)C1(CF)CC1 |
| InChI | InChI=1S/C9H18FN.C2H6/c1-4-11(8(2)3)9(7-10)5-6-9;1-2/h8H,4-7H2,1-3H3;1-2H3 |
| InChIKey | YGDMMXKUYVKUTH-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.32 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;N-ethyl-1-(fluoromethyl)-N-propan-2-ylcyclopropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-ethyl-1-(fluoromethyl)-N-propan-2-ylcyclopropan-1-amine?
The IUPAC name of ethane;N-ethyl-1-(fluoromethyl)-N-propan-2-ylcyclopropan-1-amine (CID 176685786) is ethane;N-ethyl-1-(fluoromethyl)-N-propan-2-ylcyclopropan-1-amine.
What is the SMILES notation for ethane;N-ethyl-1-(fluoromethyl)-N-propan-2-ylcyclopropan-1-amine?
The canonical SMILES for ethane;N-ethyl-1-(fluoromethyl)-N-propan-2-ylcyclopropan-1-amine is CC.CCN(C(C)C)C1(CF)CC1.
What is the InChIKey of ethane;N-ethyl-1-(fluoromethyl)-N-propan-2-ylcyclopropan-1-amine?
The InChIKey is YGDMMXKUYVKUTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18FN.C2H6/c1-4-11(8(2)3)9(7-10)5-6-9;1-2/h8H,4-7H2,1-3H3;1-2H3.
What are the key properties of ethane;N-ethyl-1-(fluoromethyl)-N-propan-2-ylcyclopropan-1-amine?
ethane;N-ethyl-1-(fluoromethyl)-N-propan-2-ylcyclopropan-1-amine has a molecular weight of 189.32 g/mol, XLogP of 3.24, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-ethyl-1-(fluoromethyl)-N-propan-2-ylcyclopropan-1-amine is sourced from PubChem (CID 176685786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).