About ethane;4-fluoro-1,6-di(propan-2-yl)-7H-cyclohepta[d]imidazole;oxolane
ethane;4-fluoro-1,6-di(propan-2-yl)-7H-cyclohepta[d]imidazole;oxolane (PubChem CID 176685848) has the molecular formula C20H33FN2O
and a molecular weight of 336.50 g/mol. Its IUPAC name is ethane;4-fluoro-1,6-di(propan-2-yl)-7H-cyclohepta[d]imidazole;oxolane.
Molecular Properties
| Compound Name | ethane;4-fluoro-1,6-di(propan-2-yl)-7H-cyclohepta[d]imidazole;oxolane |
| PubChem CID | 176685848 |
| Molecular Formula | C20H33FN2O |
| Molecular Weight | 336.50 g/mol |
| Exact Mass | 336.26 |
| IUPAC Name | ethane;4-fluoro-1,6-di(propan-2-yl)-7H-cyclohepta[d]imidazole;oxolane |
| SMILES | C1CCOC1.CC.CC(C)C1=CC(F)=c2ncn(C(C)C)c2=CC1 |
| InChI | InChI=1S/C14H19FN2.C4H8O.C2H6/c1-9(2)11-5-6-13-14(12(15)7-11)16-8-17(13)10(3)4;1-2-4-5-3-1;1-2/h6-10H,5H2,1-4H3;1-4H2;1-2H3 |
| InChIKey | RXGLNOWEQSUGQA-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.50 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;4-fluoro-1,6-di(propan-2-yl)-7H-cyclohepta[d]imidazole;oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-fluoro-1,6-di(propan-2-yl)-7H-cyclohepta[d]imidazole;oxolane?
The IUPAC name of ethane;4-fluoro-1,6-di(propan-2-yl)-7H-cyclohepta[d]imidazole;oxolane (CID 176685848) is ethane;4-fluoro-1,6-di(propan-2-yl)-7H-cyclohepta[d]imidazole;oxolane.
What is the SMILES notation for ethane;4-fluoro-1,6-di(propan-2-yl)-7H-cyclohepta[d]imidazole;oxolane?
The canonical SMILES for ethane;4-fluoro-1,6-di(propan-2-yl)-7H-cyclohepta[d]imidazole;oxolane is C1CCOC1.CC.CC(C)C1=CC(F)=c2ncn(C(C)C)c2=CC1.
What is the InChIKey of ethane;4-fluoro-1,6-di(propan-2-yl)-7H-cyclohepta[d]imidazole;oxolane?
The InChIKey is RXGLNOWEQSUGQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19FN2.C4H8O.C2H6/c1-9(2)11-5-6-13-14(12(15)7-11)16-8-17(13)10(3)4;1-2-4-5-3-1;1-2/h6-10H,5H2,1-4H3;1-4H2;1-2H3.
What are the key properties of ethane;4-fluoro-1,6-di(propan-2-yl)-7H-cyclohepta[d]imidazole;oxolane?
ethane;4-fluoro-1,6-di(propan-2-yl)-7H-cyclohepta[d]imidazole;oxolane has a molecular weight of 336.50 g/mol, XLogP of 4.13, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-fluoro-1,6-di(propan-2-yl)-7H-cyclohepta[d]imidazole;oxolane is sourced from PubChem (CID 176685848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).