About 3-[2-(diethylamino)ethyl]-2,7-dimethyl-1H-indol-4-ol
3-[2-(diethylamino)ethyl]-2,7-dimethyl-1H-indol-4-ol (PubChem CID 176685867) has the molecular formula C16H24N2O
and a molecular weight of 260.38 g/mol. Its IUPAC name is 3-[2-(diethylamino)ethyl]-2,7-dimethyl-1H-indol-4-ol.
Molecular Properties
| Compound Name | 3-[2-(diethylamino)ethyl]-2,7-dimethyl-1H-indol-4-ol |
| PubChem CID | 176685867 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 3-[2-(diethylamino)ethyl]-2,7-dimethyl-1H-indol-4-ol |
| SMILES | CCN(CC)CCc1c(C)[nH]c2c(C)ccc(O)c12 |
| InChI | InChI=1S/C16H24N2O/c1-5-18(6-2)10-9-13-12(4)17-16-11(3)7-8-14(19)15(13)16/h7-8,17,19H,5-6,9-10H2,1-4H3 |
| InChIKey | KFIBUYKGWXLOHJ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 39.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[2-(diethylamino)ethyl]-2,7-dimethyl-1H-indol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(diethylamino)ethyl]-2,7-dimethyl-1H-indol-4-ol?
The IUPAC name of 3-[2-(diethylamino)ethyl]-2,7-dimethyl-1H-indol-4-ol (CID 176685867) is 3-[2-(diethylamino)ethyl]-2,7-dimethyl-1H-indol-4-ol.
What is the SMILES notation for 3-[2-(diethylamino)ethyl]-2,7-dimethyl-1H-indol-4-ol?
The canonical SMILES for 3-[2-(diethylamino)ethyl]-2,7-dimethyl-1H-indol-4-ol is CCN(CC)CCc1c(C)[nH]c2c(C)ccc(O)c12.
What is the InChIKey of 3-[2-(diethylamino)ethyl]-2,7-dimethyl-1H-indol-4-ol?
The InChIKey is KFIBUYKGWXLOHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N2O/c1-5-18(6-2)10-9-13-12(4)17-16-11(3)7-8-14(19)15(13)16/h7-8,17,19H,5-6,9-10H2,1-4H3.
What are the key properties of 3-[2-(diethylamino)ethyl]-2,7-dimethyl-1H-indol-4-ol?
3-[2-(diethylamino)ethyl]-2,7-dimethyl-1H-indol-4-ol has a molecular weight of 260.38 g/mol, XLogP of 3.37, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(diethylamino)ethyl]-2,7-dimethyl-1H-indol-4-ol is sourced from PubChem (CID 176685867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).