C20H36F3NO2 — CID 176686317
ethane;3-(4-hydroxycyclohexyl)-N-(4-methylpent-1-en-3-yl)-N-(3,3,3-trifluoropropyl)propanamide (PubChem CID 176686317) has the molecular formula C20H36F3NO2 and a molecular weight of 379.51 g/mol. Its IUPAC name is ethane;3-(4-hydroxycyclohexyl)-N-(4-methylpent-1-en-3-yl)-N-(3,3,3-trifluoropropyl)propanamide.
| Compound Name | ethane;3-(4-hydroxycyclohexyl)-N-(4-methylpent-1-en-3-yl)-N-(3,3,3-trifluoropropyl)propanamide |
|---|---|
| PubChem CID | 176686317 |
| Molecular Formula | C20H36F3NO2 |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.27 |
| IUPAC Name | ethane;3-(4-hydroxycyclohexyl)-N-(4-methylpent-1-en-3-yl)-N-(3,3,3-trifluoropropyl)propanamide |
| SMILES | C=CC(C(C)C)N(CCC(F)(F)F)C(=O)CCC1CCC(O)CC1.CC |
| InChI | InChI=1S/C18H30F3NO2.C2H6/c1-4-16(13(2)3)22(12-11-18(19,20)21)17(24)10-7-14-5-8-15(23)9-6-14;1-2/h4,13-16,23H,1,5-12H2,2-3H3;1-2H3 |
| InChIKey | CIEYRCQEOWSJDM-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|