About 3-(4-butylphenyl)-2-(3,4-dichlorophenyl)-1,2-dihydroquinazolin-4-one
3-(4-butylphenyl)-2-(3,4-dichlorophenyl)-1,2-dihydroquinazolin-4-one (PubChem CID 176687506) has the molecular formula C24H22Cl2N2O
and a molecular weight of 425.36 g/mol. Its IUPAC name is 3-(4-butylphenyl)-2-(3,4-dichlorophenyl)-1,2-dihydroquinazolin-4-one.
Molecular Properties
| Compound Name | 3-(4-butylphenyl)-2-(3,4-dichlorophenyl)-1,2-dihydroquinazolin-4-one |
| PubChem CID | 176687506 |
| Molecular Formula | C24H22Cl2N2O |
| Molecular Weight | 425.36 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | 3-(4-butylphenyl)-2-(3,4-dichlorophenyl)-1,2-dihydroquinazolin-4-one |
| SMILES | CCCCc1ccc(N2C(=O)c3ccccc3NC2c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C24H22Cl2N2O/c1-2-3-6-16-9-12-18(13-10-16)28-23(17-11-14-20(25)21(26)15-17)27-22-8-5-4-7-19(22)24(28)29/h4-5,7-15,23,27H,2-3,6H2,1H3 |
| InChIKey | BBRPJLNTUJWCEZ-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 425.36 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(4-butylphenyl)-2-(3,4-dichlorophenyl)-1,2-dihydroquinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-butylphenyl)-2-(3,4-dichlorophenyl)-1,2-dihydroquinazolin-4-one?
The IUPAC name of 3-(4-butylphenyl)-2-(3,4-dichlorophenyl)-1,2-dihydroquinazolin-4-one (CID 176687506) is 3-(4-butylphenyl)-2-(3,4-dichlorophenyl)-1,2-dihydroquinazolin-4-one.
What is the SMILES notation for 3-(4-butylphenyl)-2-(3,4-dichlorophenyl)-1,2-dihydroquinazolin-4-one?
The canonical SMILES for 3-(4-butylphenyl)-2-(3,4-dichlorophenyl)-1,2-dihydroquinazolin-4-one is CCCCc1ccc(N2C(=O)c3ccccc3NC2c2ccc(Cl)c(Cl)c2)cc1.
What is the InChIKey of 3-(4-butylphenyl)-2-(3,4-dichlorophenyl)-1,2-dihydroquinazolin-4-one?
The InChIKey is BBRPJLNTUJWCEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22Cl2N2O/c1-2-3-6-16-9-12-18(13-10-16)28-23(17-11-14-20(25)21(26)15-17)27-22-8-5-4-7-19(22)24(28)29/h4-5,7-15,23,27H,2-3,6H2,1H3.
What are the key properties of 3-(4-butylphenyl)-2-(3,4-dichlorophenyl)-1,2-dihydroquinazolin-4-one?
3-(4-butylphenyl)-2-(3,4-dichlorophenyl)-1,2-dihydroquinazolin-4-one has a molecular weight of 425.36 g/mol, XLogP of 7.11, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-butylphenyl)-2-(3,4-dichlorophenyl)-1,2-dihydroquinazolin-4-one is sourced from PubChem (CID 176687506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).