C24H22Cl2N2O — CID 176687506
3-(4-butylphenyl)-2-(3,4-dichlorophenyl)-1,2-dihydroquinazolin-4-one (PubChem CID 176687506) has the molecular formula C24H22Cl2N2O and a molecular weight of 425.36 g/mol. Its IUPAC name is 3-(4-butylphenyl)-2-(3,4-dichlorophenyl)-1,2-dihydroquinazolin-4-one.
| Compound Name | 3-(4-butylphenyl)-2-(3,4-dichlorophenyl)-1,2-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 176687506 |
| Molecular Formula | C24H22Cl2N2O |
| Molecular Weight | 425.36 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | 3-(4-butylphenyl)-2-(3,4-dichlorophenyl)-1,2-dihydroquinazolin-4-one |
| SMILES | CCCCc1ccc(N2C(=O)c3ccccc3NC2c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C24H22Cl2N2O/c1-2-3-6-16-9-12-18(13-10-16)28-23(17-11-14-20(25)21(26)15-17)27-22-8-5-4-7-19(22)24(28)29/h4-5,7-15,23,27H,2-3,6H2,1H3 |
| InChIKey | BBRPJLNTUJWCEZ-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.36 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |