About 7-fluoro-2-pentyl-6-(1,3-thiazol-2-yl)isoquinolin-1-one
7-fluoro-2-pentyl-6-(1,3-thiazol-2-yl)isoquinolin-1-one (PubChem CID 176687893) has the molecular formula C17H17FN2OS
and a molecular weight of 316.40 g/mol. Its IUPAC name is 7-fluoro-2-pentyl-6-(1,3-thiazol-2-yl)isoquinolin-1-one.
Molecular Properties
| Compound Name | 7-fluoro-2-pentyl-6-(1,3-thiazol-2-yl)isoquinolin-1-one |
| PubChem CID | 176687893 |
| Molecular Formula | C17H17FN2OS |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 7-fluoro-2-pentyl-6-(1,3-thiazol-2-yl)isoquinolin-1-one |
| SMILES | CCCCCn1ccc2cc(-c3nccs3)c(F)cc2c1=O |
| InChI | InChI=1S/C17H17FN2OS/c1-2-3-4-7-20-8-5-12-10-14(16-19-6-9-22-16)15(18)11-13(12)17(20)21/h5-6,8-11H,2-4,7H2,1H3 |
| InChIKey | OXZSNGNHAHGFHX-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-fluoro-2-pentyl-6-(1,3-thiazol-2-yl)isoquinolin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-2-pentyl-6-(1,3-thiazol-2-yl)isoquinolin-1-one?
The IUPAC name of 7-fluoro-2-pentyl-6-(1,3-thiazol-2-yl)isoquinolin-1-one (CID 176687893) is 7-fluoro-2-pentyl-6-(1,3-thiazol-2-yl)isoquinolin-1-one.
What is the SMILES notation for 7-fluoro-2-pentyl-6-(1,3-thiazol-2-yl)isoquinolin-1-one?
The canonical SMILES for 7-fluoro-2-pentyl-6-(1,3-thiazol-2-yl)isoquinolin-1-one is CCCCCn1ccc2cc(-c3nccs3)c(F)cc2c1=O.
What is the InChIKey of 7-fluoro-2-pentyl-6-(1,3-thiazol-2-yl)isoquinolin-1-one?
The InChIKey is OXZSNGNHAHGFHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17FN2OS/c1-2-3-4-7-20-8-5-12-10-14(16-19-6-9-22-16)15(18)11-13(12)17(20)21/h5-6,8-11H,2-4,7H2,1H3.
What are the key properties of 7-fluoro-2-pentyl-6-(1,3-thiazol-2-yl)isoquinolin-1-one?
7-fluoro-2-pentyl-6-(1,3-thiazol-2-yl)isoquinolin-1-one has a molecular weight of 316.40 g/mol, XLogP of 4.45, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-2-pentyl-6-(1,3-thiazol-2-yl)isoquinolin-1-one is sourced from PubChem (CID 176687893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).