C11H17F3N2O — CID 176687937
ethane;3-(2-ethylpyrimidin-5-yl)-1,1,1-trifluoropropan-2-ol (PubChem CID 176687937) has the molecular formula C11H17F3N2O and a molecular weight of 250.26 g/mol. Its IUPAC name is ethane;3-(2-ethylpyrimidin-5-yl)-1,1,1-trifluoropropan-2-ol.
| Compound Name | ethane;3-(2-ethylpyrimidin-5-yl)-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 176687937 |
| Molecular Formula | C11H17F3N2O |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | ethane;3-(2-ethylpyrimidin-5-yl)-1,1,1-trifluoropropan-2-ol |
| SMILES | CC.CCc1ncc(CC(O)C(F)(F)F)cn1 |
| InChI | InChI=1S/C9H11F3N2O.C2H6/c1-2-8-13-4-6(5-14-8)3-7(15)9(10,11)12;1-2/h4-5,7,15H,2-3H2,1H3;1-2H3 |
| InChIKey | YPBJTAITFHGDQY-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |