C20H29N3 — CID 176689500
(E,4Z)-N-(cyclohepta-1,4,6-trien-1-ylmethyl)-4-[(Z)-1-piperidin-1-ylprop-1-enyl]iminobut-2-en-1-amine (PubChem CID 176689500) has the molecular formula C20H29N3 and a molecular weight of 311.47 g/mol. Its IUPAC name is (E,4Z)-N-(cyclohepta-1,4,6-trien-1-ylmethyl)-4-[(Z)-1-piperidin-1-ylprop-1-enyl]iminobut-2-en-1-amine.
| Compound Name | (E,4Z)-N-(cyclohepta-1,4,6-trien-1-ylmethyl)-4-[(Z)-1-piperidin-1-ylprop-1-enyl]iminobut-2-en-1-amine |
|---|---|
| PubChem CID | 176689500 |
| Molecular Formula | C20H29N3 |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.24 |
| IUPAC Name | (E,4Z)-N-(cyclohepta-1,4,6-trien-1-ylmethyl)-4-[(Z)-1-piperidin-1-ylprop-1-enyl]iminobut-2-en-1-amine |
| SMILES | C/C=C(\N=C/C=C/CNCC1=CCC=CC=C1)N1CCCCC1 |
| InChI | InChI=1S/C20H29N3/c1-2-20(23-16-10-5-11-17-23)22-15-9-8-14-21-18-19-12-6-3-4-7-13-19/h2-4,6,8-9,12-13,15,21H,5,7,10-11,14,16-18H2,1H3/b9-8+,20-2+,22-15- |
| InChIKey | YEYVCHHWJINGIF-IMIPFQGBSA-N |
| XLogP | 3.99 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|