C12H22N2S — CID 176689535
4-(2,4,4-trimethylhexan-2-yl)-1,3-dihydroimidazole-2-thione (PubChem CID 176689535) has the molecular formula C12H22N2S and a molecular weight of 226.39 g/mol. Its IUPAC name is 4-(2,4,4-trimethylhexan-2-yl)-1,3-dihydroimidazole-2-thione.
| Compound Name | 4-(2,4,4-trimethylhexan-2-yl)-1,3-dihydroimidazole-2-thione |
|---|---|
| PubChem CID | 176689535 |
| Molecular Formula | C12H22N2S |
| Molecular Weight | 226.39 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | 4-(2,4,4-trimethylhexan-2-yl)-1,3-dihydroimidazole-2-thione |
| SMILES | CCC(C)(C)CC(C)(C)c1c[nH]c(=S)[nH]1 |
| InChI | InChI=1S/C12H22N2S/c1-6-11(2,3)8-12(4,5)9-7-13-10(15)14-9/h7H,6,8H2,1-5H3,(H2,13,14,15) |
| InChIKey | NPBANZSIZCQYNE-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.39 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|