About 3-iodo-6-methyl-2H-pyrrolo[1,2-a]pyrazin-1-one
3-iodo-6-methyl-2H-pyrrolo[1,2-a]pyrazin-1-one (PubChem CID 176689665) has the molecular formula C8H7IN2O
and a molecular weight of 274.06 g/mol. Its IUPAC name is 3-iodo-6-methyl-2H-pyrrolo[1,2-a]pyrazin-1-one.
Molecular Properties
| Compound Name | 3-iodo-6-methyl-2H-pyrrolo[1,2-a]pyrazin-1-one |
| PubChem CID | 176689665 |
| Molecular Formula | C8H7IN2O |
| Molecular Weight | 274.06 g/mol |
| Exact Mass | 273.96 |
| IUPAC Name | 3-iodo-6-methyl-2H-pyrrolo[1,2-a]pyrazin-1-one |
| SMILES | Cc1ccc2c(=O)[nH]c(I)cn12 |
| InChI | InChI=1S/C8H7IN2O/c1-5-2-3-6-8(12)10-7(9)4-11(5)6/h2-4H,1H3,(H,10,12) |
| InChIKey | JKOMJQULWLZMQR-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.06 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-iodo-6-methyl-2H-pyrrolo[1,2-a]pyrazin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodo-6-methyl-2H-pyrrolo[1,2-a]pyrazin-1-one?
The IUPAC name of 3-iodo-6-methyl-2H-pyrrolo[1,2-a]pyrazin-1-one (CID 176689665) is 3-iodo-6-methyl-2H-pyrrolo[1,2-a]pyrazin-1-one.
What is the SMILES notation for 3-iodo-6-methyl-2H-pyrrolo[1,2-a]pyrazin-1-one?
The canonical SMILES for 3-iodo-6-methyl-2H-pyrrolo[1,2-a]pyrazin-1-one is Cc1ccc2c(=O)[nH]c(I)cn12.
What is the InChIKey of 3-iodo-6-methyl-2H-pyrrolo[1,2-a]pyrazin-1-one?
The InChIKey is JKOMJQULWLZMQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7IN2O/c1-5-2-3-6-8(12)10-7(9)4-11(5)6/h2-4H,1H3,(H,10,12).
What are the key properties of 3-iodo-6-methyl-2H-pyrrolo[1,2-a]pyrazin-1-one?
3-iodo-6-methyl-2H-pyrrolo[1,2-a]pyrazin-1-one has a molecular weight of 274.06 g/mol, XLogP of 1.54, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodo-6-methyl-2H-pyrrolo[1,2-a]pyrazin-1-one is sourced from PubChem (CID 176689665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).