C14H19F3N2O2 — CID 176690622
1-ethyl-5-[2-(3-methoxyazetidin-1-yl)ethyl]-4-(trifluoromethyl)pyridin-2-one (PubChem CID 176690622) has the molecular formula C14H19F3N2O2 and a molecular weight of 304.31 g/mol. Its IUPAC name is 1-ethyl-5-[2-(3-methoxyazetidin-1-yl)ethyl]-4-(trifluoromethyl)pyridin-2-one.
| Compound Name | 1-ethyl-5-[2-(3-methoxyazetidin-1-yl)ethyl]-4-(trifluoromethyl)pyridin-2-one |
|---|---|
| PubChem CID | 176690622 |
| Molecular Formula | C14H19F3N2O2 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 1-ethyl-5-[2-(3-methoxyazetidin-1-yl)ethyl]-4-(trifluoromethyl)pyridin-2-one |
| SMILES | CCn1cc(CCN2CC(OC)C2)c(C(F)(F)F)cc1=O |
| InChI | InChI=1S/C14H19F3N2O2/c1-3-19-7-10(4-5-18-8-11(9-18)21-2)12(6-13(19)20)14(15,16)17/h6-7,11H,3-5,8-9H2,1-2H3 |
| InChIKey | XOBLFDDDHQBHKT-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |