About ethane;(2R,5S)-5-methyl-2-(trifluoromethyl)oxane
ethane;(2R,5S)-5-methyl-2-(trifluoromethyl)oxane (PubChem CID 176690849) has the molecular formula C9H17F3O
and a molecular weight of 198.23 g/mol. Its IUPAC name is ethane;(2R,5S)-5-methyl-2-(trifluoromethyl)oxane.
Molecular Properties
| Compound Name | ethane;(2R,5S)-5-methyl-2-(trifluoromethyl)oxane |
| PubChem CID | 176690849 |
| Molecular Formula | C9H17F3O |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | ethane;(2R,5S)-5-methyl-2-(trifluoromethyl)oxane |
| SMILES | CC.C[C@H]1CC[C@H](C(F)(F)F)OC1 |
| InChI | InChI=1S/C7H11F3O.C2H6/c1-5-2-3-6(11-4-5)7(8,9)10;1-2/h5-6H,2-4H2,1H3;1-2H3/t5-,6+;/m0./s1 |
| InChIKey | KSFPZTHNDBJRII-RIHPBJNCSA-N |
| XLogP | 3.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;(2R,5S)-5-methyl-2-(trifluoromethyl)oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(2R,5S)-5-methyl-2-(trifluoromethyl)oxane?
The IUPAC name of ethane;(2R,5S)-5-methyl-2-(trifluoromethyl)oxane (CID 176690849) is ethane;(2R,5S)-5-methyl-2-(trifluoromethyl)oxane.
What is the SMILES notation for ethane;(2R,5S)-5-methyl-2-(trifluoromethyl)oxane?
The canonical SMILES for ethane;(2R,5S)-5-methyl-2-(trifluoromethyl)oxane is CC.C[C@H]1CC[C@H](C(F)(F)F)OC1.
What is the InChIKey of ethane;(2R,5S)-5-methyl-2-(trifluoromethyl)oxane?
The InChIKey is KSFPZTHNDBJRII-RIHPBJNCSA-N. The full InChI is InChI=1S/C7H11F3O.C2H6/c1-5-2-3-6(11-4-5)7(8,9)10;1-2/h5-6H,2-4H2,1H3;1-2H3/t5-,6+;/m0./s1.
What are the key properties of ethane;(2R,5S)-5-methyl-2-(trifluoromethyl)oxane?
ethane;(2R,5S)-5-methyl-2-(trifluoromethyl)oxane has a molecular weight of 198.23 g/mol, XLogP of 3.39, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(2R,5S)-5-methyl-2-(trifluoromethyl)oxane is sourced from PubChem (CID 176690849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).