About 5-(3,5-dimethylphenoxy)-2-(trifluoromethyl)pyrimidine;ethane;hydroiodide
5-(3,5-dimethylphenoxy)-2-(trifluoromethyl)pyrimidine;ethane;hydroiodide (PubChem CID 176690867) has the molecular formula C15H18F3IN2O
and a molecular weight of 426.22 g/mol. Its IUPAC name is 5-(3,5-dimethylphenoxy)-2-(trifluoromethyl)pyrimidine;ethane;hydroiodide.
Molecular Properties
| Compound Name | 5-(3,5-dimethylphenoxy)-2-(trifluoromethyl)pyrimidine;ethane;hydroiodide |
| PubChem CID | 176690867 |
| Molecular Formula | C15H18F3IN2O |
| Molecular Weight | 426.22 g/mol |
| Exact Mass | 426.04 |
| IUPAC Name | 5-(3,5-dimethylphenoxy)-2-(trifluoromethyl)pyrimidine;ethane;hydroiodide |
| SMILES | CC.Cc1cc(C)cc(Oc2cnc(C(F)(F)F)nc2)c1.I |
| InChI | InChI=1S/C13H11F3N2O.C2H6.HI/c1-8-3-9(2)5-10(4-8)19-11-6-17-12(18-7-11)13(14,15)16;1-2;/h3-7H,1-2H3;1-2H3;1H |
| InChIKey | NGUYHOUURJSKNR-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.22 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-(3,5-dimethylphenoxy)-2-(trifluoromethyl)pyrimidine;ethane;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,5-dimethylphenoxy)-2-(trifluoromethyl)pyrimidine;ethane;hydroiodide?
The IUPAC name of 5-(3,5-dimethylphenoxy)-2-(trifluoromethyl)pyrimidine;ethane;hydroiodide (CID 176690867) is 5-(3,5-dimethylphenoxy)-2-(trifluoromethyl)pyrimidine;ethane;hydroiodide.
What is the SMILES notation for 5-(3,5-dimethylphenoxy)-2-(trifluoromethyl)pyrimidine;ethane;hydroiodide?
The canonical SMILES for 5-(3,5-dimethylphenoxy)-2-(trifluoromethyl)pyrimidine;ethane;hydroiodide is CC.Cc1cc(C)cc(Oc2cnc(C(F)(F)F)nc2)c1.I.
What is the InChIKey of 5-(3,5-dimethylphenoxy)-2-(trifluoromethyl)pyrimidine;ethane;hydroiodide?
The InChIKey is NGUYHOUURJSKNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11F3N2O.C2H6.HI/c1-8-3-9(2)5-10(4-8)19-11-6-17-12(18-7-11)13(14,15)16;1-2;/h3-7H,1-2H3;1-2H3;1H.
What are the key properties of 5-(3,5-dimethylphenoxy)-2-(trifluoromethyl)pyrimidine;ethane;hydroiodide?
5-(3,5-dimethylphenoxy)-2-(trifluoromethyl)pyrimidine;ethane;hydroiodide has a molecular weight of 426.22 g/mol, XLogP of 5.55, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,5-dimethylphenoxy)-2-(trifluoromethyl)pyrimidine;ethane;hydroiodide is sourced from PubChem (CID 176690867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).