C15H18F3IN2O — CID 176690872
2-(3,5-dimethylphenoxy)-5-(trifluoromethyl)pyrazine;ethane;hydroiodide (PubChem CID 176690872) has the molecular formula C15H18F3IN2O and a molecular weight of 426.22 g/mol. Its IUPAC name is 2-(3,5-dimethylphenoxy)-5-(trifluoromethyl)pyrazine;ethane;hydroiodide.
| Compound Name | 2-(3,5-dimethylphenoxy)-5-(trifluoromethyl)pyrazine;ethane;hydroiodide |
|---|---|
| PubChem CID | 176690872 |
| Molecular Formula | C15H18F3IN2O |
| Molecular Weight | 426.22 g/mol |
| Exact Mass | 426.04 |
| IUPAC Name | 2-(3,5-dimethylphenoxy)-5-(trifluoromethyl)pyrazine;ethane;hydroiodide |
| SMILES | CC.Cc1cc(C)cc(Oc2cnc(C(F)(F)F)cn2)c1.I |
| InChI | InChI=1S/C13H11F3N2O.C2H6.HI/c1-8-3-9(2)5-10(4-8)19-12-7-17-11(6-18-12)13(14,15)16;1-2;/h3-7H,1-2H3;1-2H3;1H |
| InChIKey | YGIWHYNYBWZHQC-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.22 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|