C15H16F3N3O — CID 176690909
N-[(1E)-2-(6-ethyl-2-methylpyrimidin-4-yl)oxypenta-1,3,4-trienyl]-1,1,1-trifluoropropan-2-imine (PubChem CID 176690909) has the molecular formula C15H16F3N3O and a molecular weight of 311.31 g/mol. Its IUPAC name is N-[(1E)-2-(6-ethyl-2-methylpyrimidin-4-yl)oxypenta-1,3,4-trienyl]-1,1,1-trifluoropropan-2-imine.
| Compound Name | N-[(1E)-2-(6-ethyl-2-methylpyrimidin-4-yl)oxypenta-1,3,4-trienyl]-1,1,1-trifluoropropan-2-imine |
|---|---|
| PubChem CID | 176690909 |
| Molecular Formula | C15H16F3N3O |
| Molecular Weight | 311.31 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | N-[(1E)-2-(6-ethyl-2-methylpyrimidin-4-yl)oxypenta-1,3,4-trienyl]-1,1,1-trifluoropropan-2-imine |
| SMILES | C=C=C/C(=C\N=C(/C)C(F)(F)F)Oc1cc(CC)nc(C)n1 |
| InChI | InChI=1S/C15H16F3N3O/c1-5-7-13(9-19-10(3)15(16,17)18)22-14-8-12(6-2)20-11(4)21-14/h7-9H,1,6H2,2-4H3/b13-9+,19-10+ |
| InChIKey | ZDRNACNHENCMJE-LPWMAMAHSA-N |
| XLogP | 3.93 |
| TPSA | 47.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.31 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|