About 2-methyl-4-trimethylstannyl-1H-pyrimidin-6-one;trifluoromethylcyclohexane
2-methyl-4-trimethylstannyl-1H-pyrimidin-6-one;trifluoromethylcyclohexane (PubChem CID 176690941) has the molecular formula C15H25F3N2OSn
and a molecular weight of 425.08 g/mol. Its IUPAC name is 2-methyl-4-trimethylstannyl-1H-pyrimidin-6-one;trifluoromethylcyclohexane.
Molecular Properties
| Compound Name | 2-methyl-4-trimethylstannyl-1H-pyrimidin-6-one;trifluoromethylcyclohexane |
| PubChem CID | 176690941 |
| Molecular Formula | C15H25F3N2OSn |
| Molecular Weight | 425.08 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | 2-methyl-4-trimethylstannyl-1H-pyrimidin-6-one;trifluoromethylcyclohexane |
| SMILES | Cc1nc([Sn](C)(C)C)cc(=O)[nH]1.FC(F)(F)C1CCCCC1 |
| InChI | InChI=1S/C7H11F3.C5H5N2O.3CH3.Sn/c8-7(9,10)6-4-2-1-3-5-6;1-4-6-3-2-5(8)7-4;;;;/h6H,1-5H2;2H,1H3,(H,6,7,8);3*1H3; |
| InChIKey | IHNMXOWBGIAENR-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.08 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-4-trimethylstannyl-1H-pyrimidin-6-one;trifluoromethylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-trimethylstannyl-1H-pyrimidin-6-one;trifluoromethylcyclohexane?
The IUPAC name of 2-methyl-4-trimethylstannyl-1H-pyrimidin-6-one;trifluoromethylcyclohexane (CID 176690941) is 2-methyl-4-trimethylstannyl-1H-pyrimidin-6-one;trifluoromethylcyclohexane.
What is the SMILES notation for 2-methyl-4-trimethylstannyl-1H-pyrimidin-6-one;trifluoromethylcyclohexane?
The canonical SMILES for 2-methyl-4-trimethylstannyl-1H-pyrimidin-6-one;trifluoromethylcyclohexane is Cc1nc([Sn](C)(C)C)cc(=O)[nH]1.FC(F)(F)C1CCCCC1.
What is the InChIKey of 2-methyl-4-trimethylstannyl-1H-pyrimidin-6-one;trifluoromethylcyclohexane?
The InChIKey is IHNMXOWBGIAENR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11F3.C5H5N2O.3CH3.Sn/c8-7(9,10)6-4-2-1-3-5-6;1-4-6-3-2-5(8)7-4;;;;/h6H,1-5H2;2H,1H3,(H,6,7,8);3*1H3;.
What are the key properties of 2-methyl-4-trimethylstannyl-1H-pyrimidin-6-one;trifluoromethylcyclohexane?
2-methyl-4-trimethylstannyl-1H-pyrimidin-6-one;trifluoromethylcyclohexane has a molecular weight of 425.08 g/mol, XLogP of 3.75, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-trimethylstannyl-1H-pyrimidin-6-one;trifluoromethylcyclohexane is sourced from PubChem (CID 176690941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).