C17H23F3N2O — CID 176690989
2-(3,5-dimethylphenoxy)-5-(trifluoromethyl)pyrazine;ethane (PubChem CID 176690989) has the molecular formula C17H23F3N2O and a molecular weight of 328.38 g/mol. Its IUPAC name is 2-(3,5-dimethylphenoxy)-5-(trifluoromethyl)pyrazine;ethane.
| Compound Name | 2-(3,5-dimethylphenoxy)-5-(trifluoromethyl)pyrazine;ethane |
|---|---|
| PubChem CID | 176690989 |
| Molecular Formula | C17H23F3N2O |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 2-(3,5-dimethylphenoxy)-5-(trifluoromethyl)pyrazine;ethane |
| SMILES | CC.CC.Cc1cc(C)cc(Oc2cnc(C(F)(F)F)cn2)c1 |
| InChI | InChI=1S/C13H11F3N2O.2C2H6/c1-8-3-9(2)5-10(4-8)19-12-7-17-11(6-18-12)13(14,15)16;2*1-2/h3-7H,1-2H3;2*1-2H3 |
| InChIKey | JSMJDKKFJDQOFE-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |