C17H29F3N2O — CID 176691029
ethane;4-methyl-6-[[4-(trifluoromethyl)cyclohexyl]methoxy]pyrimidine (PubChem CID 176691029) has the molecular formula C17H29F3N2O and a molecular weight of 334.43 g/mol. Its IUPAC name is ethane;4-methyl-6-[[4-(trifluoromethyl)cyclohexyl]methoxy]pyrimidine.
| Compound Name | ethane;4-methyl-6-[[4-(trifluoromethyl)cyclohexyl]methoxy]pyrimidine |
|---|---|
| PubChem CID | 176691029 |
| Molecular Formula | C17H29F3N2O |
| Molecular Weight | 334.43 g/mol |
| Exact Mass | 334.22 |
| IUPAC Name | ethane;4-methyl-6-[[4-(trifluoromethyl)cyclohexyl]methoxy]pyrimidine |
| SMILES | CC.CC.Cc1cc(OCC2CCC(C(F)(F)F)CC2)ncn1 |
| InChI | InChI=1S/C13H17F3N2O.2C2H6/c1-9-6-12(18-8-17-9)19-7-10-2-4-11(5-3-10)13(14,15)16;2*1-2/h6,8,10-11H,2-5,7H2,1H3;2*1-2H3 |
| InChIKey | PTWHIEGRDCUEOH-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.43 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |