About ethane;2-methyl-4-(3-methyl-3-azabicyclo[3.1.0]hexan-6-yl)-1,3-oxazole
ethane;2-methyl-4-(3-methyl-3-azabicyclo[3.1.0]hexan-6-yl)-1,3-oxazole (PubChem CID 176692737) has the molecular formula C12H20N2O
and a molecular weight of 208.30 g/mol. Its IUPAC name is ethane;2-methyl-4-(3-methyl-3-azabicyclo[3.1.0]hexan-6-yl)-1,3-oxazole.
Molecular Properties
| Compound Name | ethane;2-methyl-4-(3-methyl-3-azabicyclo[3.1.0]hexan-6-yl)-1,3-oxazole |
| PubChem CID | 176692737 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | ethane;2-methyl-4-(3-methyl-3-azabicyclo[3.1.0]hexan-6-yl)-1,3-oxazole |
| SMILES | CC.Cc1nc(C2C3CN(C)CC32)co1 |
| InChI | InChI=1S/C10H14N2O.C2H6/c1-6-11-9(5-13-6)10-7-3-12(2)4-8(7)10;1-2/h5,7-8,10H,3-4H2,1-2H3;1-2H3 |
| InChIKey | UKYJHZOWKVDWOS-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;2-methyl-4-(3-methyl-3-azabicyclo[3.1.0]hexan-6-yl)-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methyl-4-(3-methyl-3-azabicyclo[3.1.0]hexan-6-yl)-1,3-oxazole?
The IUPAC name of ethane;2-methyl-4-(3-methyl-3-azabicyclo[3.1.0]hexan-6-yl)-1,3-oxazole (CID 176692737) is ethane;2-methyl-4-(3-methyl-3-azabicyclo[3.1.0]hexan-6-yl)-1,3-oxazole.
What is the SMILES notation for ethane;2-methyl-4-(3-methyl-3-azabicyclo[3.1.0]hexan-6-yl)-1,3-oxazole?
The canonical SMILES for ethane;2-methyl-4-(3-methyl-3-azabicyclo[3.1.0]hexan-6-yl)-1,3-oxazole is CC.Cc1nc(C2C3CN(C)CC32)co1.
What is the InChIKey of ethane;2-methyl-4-(3-methyl-3-azabicyclo[3.1.0]hexan-6-yl)-1,3-oxazole?
The InChIKey is UKYJHZOWKVDWOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O.C2H6/c1-6-11-9(5-13-6)10-7-3-12(2)4-8(7)10;1-2/h5,7-8,10H,3-4H2,1-2H3;1-2H3.
What are the key properties of ethane;2-methyl-4-(3-methyl-3-azabicyclo[3.1.0]hexan-6-yl)-1,3-oxazole?
ethane;2-methyl-4-(3-methyl-3-azabicyclo[3.1.0]hexan-6-yl)-1,3-oxazole has a molecular weight of 208.30 g/mol, XLogP of 2.28, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methyl-4-(3-methyl-3-azabicyclo[3.1.0]hexan-6-yl)-1,3-oxazole is sourced from PubChem (CID 176692737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).