About ethane;2-ethyl-4,5-dimethyl-1,3-thiazole;(4-ethyl-1-methylpyrazol-3-yl)methanamine
ethane;2-ethyl-4,5-dimethyl-1,3-thiazole;(4-ethyl-1-methylpyrazol-3-yl)methanamine (PubChem CID 176693410) has the molecular formula C16H30N4S
and a molecular weight of 310.51 g/mol. Its IUPAC name is ethane;2-ethyl-4,5-dimethyl-1,3-thiazole;(4-ethyl-1-methylpyrazol-3-yl)methanamine.
Molecular Properties
| Compound Name | ethane;2-ethyl-4,5-dimethyl-1,3-thiazole;(4-ethyl-1-methylpyrazol-3-yl)methanamine |
| PubChem CID | 176693410 |
| Molecular Formula | C16H30N4S |
| Molecular Weight | 310.51 g/mol |
| Exact Mass | 310.22 |
| IUPAC Name | ethane;2-ethyl-4,5-dimethyl-1,3-thiazole;(4-ethyl-1-methylpyrazol-3-yl)methanamine |
| SMILES | CC.CCc1cn(C)nc1CN.CCc1nc(C)c(C)s1 |
| InChI | InChI=1S/C7H13N3.C7H11NS.C2H6/c1-3-6-5-10(2)9-7(6)4-8;1-4-7-8-5(2)6(3)9-7;1-2/h5H,3-4,8H2,1-2H3;4H2,1-3H3;1-2H3 |
| InChIKey | GLGJCYBALLCBDL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.51 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethane;2-ethyl-4,5-dimethyl-1,3-thiazole;(4-ethyl-1-methylpyrazol-3-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-ethyl-4,5-dimethyl-1,3-thiazole;(4-ethyl-1-methylpyrazol-3-yl)methanamine?
The IUPAC name of ethane;2-ethyl-4,5-dimethyl-1,3-thiazole;(4-ethyl-1-methylpyrazol-3-yl)methanamine (CID 176693410) is ethane;2-ethyl-4,5-dimethyl-1,3-thiazole;(4-ethyl-1-methylpyrazol-3-yl)methanamine.
What is the SMILES notation for ethane;2-ethyl-4,5-dimethyl-1,3-thiazole;(4-ethyl-1-methylpyrazol-3-yl)methanamine?
The canonical SMILES for ethane;2-ethyl-4,5-dimethyl-1,3-thiazole;(4-ethyl-1-methylpyrazol-3-yl)methanamine is CC.CCc1cn(C)nc1CN.CCc1nc(C)c(C)s1.
What is the InChIKey of ethane;2-ethyl-4,5-dimethyl-1,3-thiazole;(4-ethyl-1-methylpyrazol-3-yl)methanamine?
The InChIKey is GLGJCYBALLCBDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3.C7H11NS.C2H6/c1-3-6-5-10(2)9-7(6)4-8;1-4-7-8-5(2)6(3)9-7;1-2/h5H,3-4,8H2,1-2H3;4H2,1-3H3;1-2H3.
What are the key properties of ethane;2-ethyl-4,5-dimethyl-1,3-thiazole;(4-ethyl-1-methylpyrazol-3-yl)methanamine?
ethane;2-ethyl-4,5-dimethyl-1,3-thiazole;(4-ethyl-1-methylpyrazol-3-yl)methanamine has a molecular weight of 310.51 g/mol, XLogP of 3.79, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-ethyl-4,5-dimethyl-1,3-thiazole;(4-ethyl-1-methylpyrazol-3-yl)methanamine is sourced from PubChem (CID 176693410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).