C9H26N2 — CID 176693737
ethane;N'-ethyl-N,N'-dimethylmethanediamine (PubChem CID 176693737) has the molecular formula C9H26N2 and a molecular weight of 162.32 g/mol. Its IUPAC name is ethane;N'-ethyl-N,N'-dimethylmethanediamine.
| Compound Name | ethane;N'-ethyl-N,N'-dimethylmethanediamine |
|---|---|
| PubChem CID | 176693737 |
| Molecular Formula | C9H26N2 |
| Molecular Weight | 162.32 g/mol |
| Exact Mass | 162.21 |
| IUPAC Name | ethane;N'-ethyl-N,N'-dimethylmethanediamine |
| SMILES | CC.CC.CCN(C)CNC |
| InChI | InChI=1S/C5H14N2.2C2H6/c1-4-7(3)5-6-2;2*1-2/h6H,4-5H2,1-3H3;2*1-2H3 |
| InChIKey | AGSMBNIBBBJVLQ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.32 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|