C7H5Br2NO3 — CID 176693825
3,4-dibromo-1-(2-oxopropyl)pyrrole-2,5-dione (PubChem CID 176693825) has the molecular formula C7H5Br2NO3 and a molecular weight of 310.93 g/mol. Its IUPAC name is 3,4-dibromo-1-(2-oxopropyl)pyrrole-2,5-dione.
| Compound Name | 3,4-dibromo-1-(2-oxopropyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 176693825 |
| Molecular Formula | C7H5Br2NO3 |
| Molecular Weight | 310.93 g/mol |
| Exact Mass | 308.86 |
| IUPAC Name | 3,4-dibromo-1-(2-oxopropyl)pyrrole-2,5-dione |
| SMILES | CC(=O)CN1C(=O)C(Br)=C(Br)C1=O |
| InChI | InChI=1S/C7H5Br2NO3/c1-3(11)2-10-6(12)4(8)5(9)7(10)13/h2H2,1H3 |
| InChIKey | KVKRWCVTSVVSDC-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.93 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|