C23H26BF5N4OS — CID 176694603
CID 176694603 (PubChem CID 176694603) has the molecular formula C23H26BF5N4OS and a molecular weight of 512.36 g/mol.
| Compound Name | CID 176694603 |
|---|---|
| PubChem CID | 176694603 |
| Molecular Formula | C23H26BF5N4OS |
| Molecular Weight | 512.36 g/mol |
| Exact Mass | 512.18 |
| IUPAC Name | — |
| SMILES | [B]C(C)(O)c1nc(N2CCC(F)(F)C(C)C2)c(C(=C)Nc2ccnc(S(=C)C)c2)cc1C(F)(F)F |
| InChI | InChI=1S/C23H26BF5N4OS/c1-13-12-33(9-7-22(13,25)26)20-16(11-17(23(27,28)29)19(32-20)21(3,24)34)14(2)31-15-6-8-30-18(10-15)35(4)5/h6,8,10-11,13,34H,2,4,7,9,12H2,1,3,5H3,(H,30,31) |
| InChIKey | SBGUHLGOWGXBLJ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.36 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|