C21H26N6OS — CID 176694780
3-(methylsulfanylamino)-N-[3-(6-piperidin-3-yl-2-pyridinyl)pyrazolo[1,5-a]pyridin-5-yl]propanamide (PubChem CID 176694780) has the molecular formula C21H26N6OS and a molecular weight of 410.55 g/mol. Its IUPAC name is 3-(methylsulfanylamino)-N-[3-(6-piperidin-3-yl-2-pyridinyl)pyrazolo[1,5-a]pyridin-5-yl]propanamide.
| Compound Name | 3-(methylsulfanylamino)-N-[3-(6-piperidin-3-yl-2-pyridinyl)pyrazolo[1,5-a]pyridin-5-yl]propanamide |
|---|---|
| PubChem CID | 176694780 |
| Molecular Formula | C21H26N6OS |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | 3-(methylsulfanylamino)-N-[3-(6-piperidin-3-yl-2-pyridinyl)pyrazolo[1,5-a]pyridin-5-yl]propanamide |
| SMILES | CSNCCC(=O)Nc1ccn2ncc(-c3cccc(C4CCCNC4)n3)c2c1 |
| InChI | InChI=1S/C21H26N6OS/c1-29-24-10-7-21(28)25-16-8-11-27-20(12-16)17(14-23-27)19-6-2-5-18(26-19)15-4-3-9-22-13-15/h2,5-6,8,11-12,14-15,22,24H,3-4,7,9-10,13H2,1H3,(H,25,28) |
| InChIKey | ZOFCRPQLGUHVKQ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 83.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|