About 5-nitroso-3-azoniatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene
5-nitroso-3-azoniatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene (PubChem CID 176696411) has the molecular formula C10H11N2O+
and a molecular weight of 175.21 g/mol. Its IUPAC name is 5-nitroso-3-azoniatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene.
Molecular Properties
| Compound Name | 5-nitroso-3-azoniatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene |
| PubChem CID | 176696411 |
| Molecular Formula | C10H11N2O+ |
| Molecular Weight | 175.21 g/mol |
| Exact Mass | 175.09 |
| IUPAC Name | 5-nitroso-3-azoniatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene |
| SMILES | O=Nc1c[nH+]c2c(c1)C1CCC2C1 |
| InChI | InChI=1S/C10H10N2O/c13-12-8-4-9-6-1-2-7(3-6)10(9)11-5-8/h4-7H,1-3H2/p+1 |
| InChIKey | KFKOWBGATIYUTH-UHFFFAOYSA-O |
| XLogP | 2.26 |
| TPSA | 43.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.21 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-nitroso-3-azoniatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitroso-3-azoniatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene?
The IUPAC name of 5-nitroso-3-azoniatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene (CID 176696411) is 5-nitroso-3-azoniatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene.
What is the SMILES notation for 5-nitroso-3-azoniatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene?
The canonical SMILES for 5-nitroso-3-azoniatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene is O=Nc1c[nH+]c2c(c1)C1CCC2C1.
What is the InChIKey of 5-nitroso-3-azoniatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene?
The InChIKey is KFKOWBGATIYUTH-UHFFFAOYSA-O. The full InChI is InChI=1S/C10H10N2O/c13-12-8-4-9-6-1-2-7(3-6)10(9)11-5-8/h4-7H,1-3H2/p+1.
What are the key properties of 5-nitroso-3-azoniatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene?
5-nitroso-3-azoniatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene has a molecular weight of 175.21 g/mol, XLogP of 2.26, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitroso-3-azoniatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene is sourced from PubChem (CID 176696411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).