C18H19ClN6O3 — CID 176696504
amino-[5-chloro-3-[[2-(3,4-dimethoxyanilino)pyrimidin-4-yl]amino]-2-pyridinyl]methanol (PubChem CID 176696504) has the molecular formula C18H19ClN6O3 and a molecular weight of 402.84 g/mol. Its IUPAC name is amino-[5-chloro-3-[[2-(3,4-dimethoxyanilino)pyrimidin-4-yl]amino]-2-pyridinyl]methanol.
| Compound Name | amino-[5-chloro-3-[[2-(3,4-dimethoxyanilino)pyrimidin-4-yl]amino]-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 176696504 |
| Molecular Formula | C18H19ClN6O3 |
| Molecular Weight | 402.84 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | amino-[5-chloro-3-[[2-(3,4-dimethoxyanilino)pyrimidin-4-yl]amino]-2-pyridinyl]methanol |
| SMILES | COc1ccc(Nc2nccc(Nc3cc(Cl)cnc3C(N)O)n2)cc1OC |
| InChI | InChI=1S/C18H19ClN6O3/c1-27-13-4-3-11(8-14(13)28-2)23-18-21-6-5-15(25-18)24-12-7-10(19)9-22-16(12)17(20)26/h3-9,17,26H,20H2,1-2H3,(H2,21,23,24,25) |
| InChIKey | FMBJANLXXTWCMO-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 127.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.84 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|