C22H32N2O5 — CID 176696935
(1R,4S,5R,8S,9R,10R,12R,13R)-N-[(2-methoxy-4-pyridinyl)methyl]-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-amine (PubChem CID 176696935) has the molecular formula C22H32N2O5 and a molecular weight of 404.51 g/mol. Its IUPAC name is (1R,4S,5R,8S,9R,10R,12R,13R)-N-[(2-methoxy-4-pyridinyl)methyl]-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-amine.
| Compound Name | (1R,4S,5R,8S,9R,10R,12R,13R)-N-[(2-methoxy-4-pyridinyl)methyl]-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-amine |
|---|---|
| PubChem CID | 176696935 |
| Molecular Formula | C22H32N2O5 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | (1R,4S,5R,8S,9R,10R,12R,13R)-N-[(2-methoxy-4-pyridinyl)methyl]-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-amine |
| SMILES | COc1cc(CN[C@@H]2O[C@@H]3O[C@@]4(C)CC[C@H]5[C@H](C)CC[C@@H]([C@H]2C)[C@@]35OO4)ccn1 |
| InChI | InChI=1S/C22H32N2O5/c1-13-5-6-17-14(2)19(24-12-15-8-10-23-18(11-15)25-4)26-20-22(17)16(13)7-9-21(3,27-20)28-29-22/h8,10-11,13-14,16-17,19-20,24H,5-7,9,12H2,1-4H3/t13-,14-,16+,17+,19-,20-,21-,22-/m1/s1 |
| InChIKey | LPLSCCKAMNDIOI-ISIOTJORSA-N |
| XLogP | 3.39 |
| TPSA | 71.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|