C22H31NO4 — CID 176697262
(1R,4S,5R,8S,9R,10R,12R,13R)-N-benzyl-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-amine (PubChem CID 176697262) has the molecular formula C22H31NO4 and a molecular weight of 373.49 g/mol. Its IUPAC name is (1R,4S,5R,8S,9R,10R,12R,13R)-N-benzyl-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-amine.
| Compound Name | (1R,4S,5R,8S,9R,10R,12R,13R)-N-benzyl-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-amine |
|---|---|
| PubChem CID | 176697262 |
| Molecular Formula | C22H31NO4 |
| Molecular Weight | 373.49 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | (1R,4S,5R,8S,9R,10R,12R,13R)-N-benzyl-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-amine |
| SMILES | C[C@H]1[C@H](NCc2ccccc2)O[C@@H]2O[C@@]3(C)CC[C@H]4[C@H](C)CC[C@@H]1[C@@]24OO3 |
| InChI | InChI=1S/C22H31NO4/c1-14-9-10-18-15(2)19(23-13-16-7-5-4-6-8-16)24-20-22(18)17(14)11-12-21(3,25-20)26-27-22/h4-8,14-15,17-20,23H,9-13H2,1-3H3/t14-,15-,17+,18+,19-,20-,21-,22-/m1/s1 |
| InChIKey | UMWUEXHVBQQMHM-KUNJXQGOSA-N |
| XLogP | 3.98 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.49 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|