C8H9NO2 — CID 176697561
1,3,4,6-tetrahydropyrano[4,3-c]pyridin-5-one (PubChem CID 176697561) has the molecular formula C8H9NO2 and a molecular weight of 151.17 g/mol. Its IUPAC name is 1,3,4,6-tetrahydropyrano[4,3-c]pyridin-5-one.
| Compound Name | 1,3,4,6-tetrahydropyrano[4,3-c]pyridin-5-one |
|---|---|
| PubChem CID | 176697561 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.17 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | 1,3,4,6-tetrahydropyrano[4,3-c]pyridin-5-one |
| SMILES | O=c1[nH]ccc2c1CCOC2 |
| InChI | InChI=1S/C8H9NO2/c10-8-7-2-4-11-5-6(7)1-3-9-8/h1,3H,2,4-5H2,(H,9,10) |
| InChIKey | WAWYQEOTEWGGTD-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.17 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |