About 2,2-dimethyl-5-methylsulfanyl-3H-1,4-benzoxazepine
2,2-dimethyl-5-methylsulfanyl-3H-1,4-benzoxazepine (PubChem CID 176697602) has the molecular formula C12H15NOS
and a molecular weight of 221.33 g/mol. Its IUPAC name is 2,2-dimethyl-5-methylsulfanyl-3H-1,4-benzoxazepine.
Molecular Properties
| Compound Name | 2,2-dimethyl-5-methylsulfanyl-3H-1,4-benzoxazepine |
| PubChem CID | 176697602 |
| Molecular Formula | C12H15NOS |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 2,2-dimethyl-5-methylsulfanyl-3H-1,4-benzoxazepine |
| SMILES | CSC1=NCC(C)(C)Oc2ccccc21 |
| InChI | InChI=1S/C12H15NOS/c1-12(2)8-13-11(15-3)9-6-4-5-7-10(9)14-12/h4-7H,8H2,1-3H3 |
| InChIKey | OHTQZUJVTJQSKO-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,2-dimethyl-5-methylsulfanyl-3H-1,4-benzoxazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-5-methylsulfanyl-3H-1,4-benzoxazepine?
The IUPAC name of 2,2-dimethyl-5-methylsulfanyl-3H-1,4-benzoxazepine (CID 176697602) is 2,2-dimethyl-5-methylsulfanyl-3H-1,4-benzoxazepine.
What is the SMILES notation for 2,2-dimethyl-5-methylsulfanyl-3H-1,4-benzoxazepine?
The canonical SMILES for 2,2-dimethyl-5-methylsulfanyl-3H-1,4-benzoxazepine is CSC1=NCC(C)(C)Oc2ccccc21.
What is the InChIKey of 2,2-dimethyl-5-methylsulfanyl-3H-1,4-benzoxazepine?
The InChIKey is OHTQZUJVTJQSKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NOS/c1-12(2)8-13-11(15-3)9-6-4-5-7-10(9)14-12/h4-7H,8H2,1-3H3.
What are the key properties of 2,2-dimethyl-5-methylsulfanyl-3H-1,4-benzoxazepine?
2,2-dimethyl-5-methylsulfanyl-3H-1,4-benzoxazepine has a molecular weight of 221.33 g/mol, XLogP of 2.97, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-5-methylsulfanyl-3H-1,4-benzoxazepine is sourced from PubChem (CID 176697602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).